C18H28N6O — CID 111600516
1-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111600516) has the molecular formula C18H28N6O and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111600516 |
| Molecular Formula | C18H28N6O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 1-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | Cc1cccn2cc(CCN/C(N)=N/CCCN3CCOCC3)nc12 |
| InChI | InChI=1S/C18H28N6O/c1-15-4-2-9-24-14-16(22-17(15)24)5-7-21-18(19)20-6-3-8-23-10-12-25-13-11-23/h2,4,9,14H,3,5-8,10-13H2,1H3,(H3,19,20,21) |
| InChIKey | NQPCDKIGCWHDHO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|