C15H27N5O2 — CID 111806660
1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111806660) has the molecular formula C15H27N5O2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111806660 |
| Molecular Formula | C15H27N5O2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | Cc1noc(C)c1CCN/C(N)=N/CCCN1CCOCC1 |
| InChI | InChI=1S/C15H27N5O2/c1-12-14(13(2)22-19-12)4-6-18-15(16)17-5-3-7-20-8-10-21-11-9-20/h3-11H2,1-2H3,(H3,16,17,18) |
| InChIKey | UOXRWWYHGKPMIM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|