C15H26N4OS — CID 111550794
(3R)-N-ethyl-3-hydroxy-N'-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]pyrrolidine-1-carboximidamide (PubChem CID 111550794) has the molecular formula C15H26N4OS and a molecular weight of 310.47 g/mol. Its IUPAC name is (3R)-N-ethyl-3-hydroxy-N'-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]pyrrolidine-1-carboximidamide.
| Compound Name | (3R)-N-ethyl-3-hydroxy-N'-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111550794 |
| Molecular Formula | C15H26N4OS |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (3R)-N-ethyl-3-hydroxy-N'-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1csc(C(C)C)n1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C15H26N4OS/c1-4-16-15(19-8-6-13(20)9-19)17-7-5-12-10-21-14(18-12)11(2)3/h10-11,13,20H,4-9H2,1-3H3,(H,16,17)/t13-/m1/s1 |
| InChIKey | BOCKIWWTMDPBPG-CYBMUJFWSA-N |
| XLogP | 1.84 |
| TPSA | 60.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|