C20H32F3IN4O — CID 111551455
(3R)-N'-[2-(diethylamino)-2-[4-(trifluoromethyl)phenyl]ethyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111551455) has the molecular formula C20H32F3IN4O and a molecular weight of 528.40 g/mol. Its IUPAC name is (3R)-N'-[2-(diethylamino)-2-[4-(trifluoromethyl)phenyl]ethyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | (3R)-N'-[2-(diethylamino)-2-[4-(trifluoromethyl)phenyl]ethyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111551455 |
| Molecular Formula | C20H32F3IN4O |
| Molecular Weight | 528.40 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | (3R)-N'-[2-(diethylamino)-2-[4-(trifluoromethyl)phenyl]ethyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccc(C(F)(F)F)cc1)N(CC)CC)N1CC[C@@H](O)C1.I |
| InChI | InChI=1S/C20H31F3N4O.HI/c1-4-24-19(27-12-11-17(28)14-27)25-13-18(26(5-2)6-3)15-7-9-16(10-8-15)20(21,22)23;/h7-10,17-18,28H,4-6,11-14H2,1-3H3,(H,24,25);1H/t17-,18?;/m1./s1 |
| InChIKey | QEOBBPJIFRCALH-XRVQSCEISA-N |
| XLogP | 3.74 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|