C15H15N3O3 — CID 111562107
4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]-5-methyl-2-pyrrol-1-ylfuran-3-carbonitrile (PubChem CID 111562107) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]-5-methyl-2-pyrrol-1-ylfuran-3-carbonitrile.
| Compound Name | 4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]-5-methyl-2-pyrrol-1-ylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 111562107 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]-5-methyl-2-pyrrol-1-ylfuran-3-carbonitrile |
| SMILES | Cc1oc(-n2cccc2)c(C#N)c1C(=O)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C15H15N3O3/c1-10-13(14(20)18-7-4-11(19)9-18)12(8-16)15(21-10)17-5-2-3-6-17/h2-3,5-6,11,19H,4,7,9H2,1H3/t11-/m1/s1 |
| InChIKey | IEESBGUSIRHJSE-LLVKDONJSA-N |
| XLogP | 1.46 |
| TPSA | 82.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|