C16H15FN4O2 — CID 111565667
N-[2-(2-fluorophenyl)-2-hydroxyethyl]-1-methylbenzotriazole-5-carboxamide (PubChem CID 111565667) has the molecular formula C16H15FN4O2 and a molecular weight of 314.32 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-2-hydroxyethyl]-1-methylbenzotriazole-5-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)-2-hydroxyethyl]-1-methylbenzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 111565667 |
| Molecular Formula | C16H15FN4O2 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N-[2-(2-fluorophenyl)-2-hydroxyethyl]-1-methylbenzotriazole-5-carboxamide |
| SMILES | Cn1nnc2cc(C(=O)NCC(O)c3ccccc3F)ccc21 |
| InChI | InChI=1S/C16H15FN4O2/c1-21-14-7-6-10(8-13(14)19-20-21)16(23)18-9-15(22)11-4-2-3-5-12(11)17/h2-8,15,22H,9H2,1H3,(H,18,23) |
| InChIKey | UATOWVAXGZFOBI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |