C31H37N3O4 — CID 11156572
2-cyclopentyl-N-[[3-[4-(1,3-dioxoisoindol-2-yl)butyl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-2-hydroxy-2-phenylacetamide (PubChem CID 11156572) has the molecular formula C31H37N3O4 and a molecular weight of 515.65 g/mol. Its IUPAC name is 2-cyclopentyl-N-[[3-[4-(1,3-dioxoisoindol-2-yl)butyl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-2-hydroxy-2-phenylacetamide.
| Compound Name | 2-cyclopentyl-N-[[3-[4-(1,3-dioxoisoindol-2-yl)butyl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 11156572 |
| Molecular Formula | C31H37N3O4 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | 2-cyclopentyl-N-[[3-[4-(1,3-dioxoisoindol-2-yl)butyl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-2-hydroxy-2-phenylacetamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCN1CC2C(CNC(=O)C(O)(c3ccccc3)C3CCCC3)C2C1 |
| InChI | InChI=1S/C31H37N3O4/c35-28-23-14-6-7-15-24(23)29(36)34(28)17-9-8-16-33-19-26-25(27(26)20-33)18-32-30(37)31(38,22-12-4-5-13-22)21-10-2-1-3-11-21/h1-3,6-7,10-11,14-15,22,25-27,38H,4-5,8-9,12-13,16-20H2,(H,32,37) |
| InChIKey | KXABMHLCZSKNCW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|