C18H34IN7 — CID 111568750
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(2-ethylpiperidin-1-yl)ethyl]-3-prop-2-enylguanidine;hydroiodide (PubChem CID 111568750) has the molecular formula C18H34IN7 and a molecular weight of 475.42 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(2-ethylpiperidin-1-yl)ethyl]-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(2-ethylpiperidin-1-yl)ethyl]-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111568750 |
| Molecular Formula | C18H34IN7 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(2-ethylpiperidin-1-yl)ethyl]-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)NCCN1CCCCC1CC.I |
| InChI | InChI=1S/C18H33N7.HI/c1-5-10-19-18(21-14-17-23-22-15(3)24(17)4)20-11-13-25-12-8-7-9-16(25)6-2;/h5,16H,1,6-14H2,2-4H3,(H2,19,20,21);1H |
| InChIKey | QBLOUPUDCSPVSB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|