C16H17NO3 — CID 111579038
1-(furan-2-yl)-2-[(4-prop-2-ynoxyphenyl)methylamino]ethanol (PubChem CID 111579038) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[(4-prop-2-ynoxyphenyl)methylamino]ethanol.
| Compound Name | 1-(furan-2-yl)-2-[(4-prop-2-ynoxyphenyl)methylamino]ethanol |
|---|---|
| PubChem CID | 111579038 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 1-(furan-2-yl)-2-[(4-prop-2-ynoxyphenyl)methylamino]ethanol |
| SMILES | C#CCOc1ccc(CNCC(O)c2ccco2)cc1 |
| InChI | InChI=1S/C16H17NO3/c1-2-9-19-14-7-5-13(6-8-14)11-17-12-15(18)16-4-3-10-20-16/h1,3-8,10,15,17-18H,9,11-12H2 |
| InChIKey | PFZDRAFBJISWKH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|