C23H35N5O2 — CID 111580833
1-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-3-ethyl-2-[(1-methylpyrazol-4-yl)methyl]guanidine (PubChem CID 111580833) has the molecular formula C23H35N5O2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 1-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-3-ethyl-2-[(1-methylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-3-ethyl-2-[(1-methylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111580833 |
| Molecular Formula | C23H35N5O2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | 1-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-3-ethyl-2-[(1-methylpyrazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cnn(C)c1)NCC1(c2ccc(OC)c(OC)c2)CCCCC1 |
| InChI | InChI=1S/C23H35N5O2/c1-5-24-22(25-14-18-15-27-28(2)16-18)26-17-23(11-7-6-8-12-23)19-9-10-20(29-3)21(13-19)30-4/h9-10,13,15-16H,5-8,11-12,14,17H2,1-4H3,(H2,24,25,26) |
| InChIKey | OBVMPFSGBUOHOG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|