C24H35IN4O4 — CID 111580850
2-[[N-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-N'-methylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide (PubChem CID 111580850) has the molecular formula C24H35IN4O4 and a molecular weight of 570.47 g/mol. Its IUPAC name is 2-[[N-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-N'-methylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-N'-methylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111580850 |
| Molecular Formula | C24H35IN4O4 |
| Molecular Weight | 570.47 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | 2-[[N-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-N'-methylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NCc1ccco1)NCC1(c2ccc(OC)c(OC)c2)CCCCC1.I |
| InChI | InChI=1S/C24H34N4O4.HI/c1-25-23(27-16-22(29)26-15-19-8-7-13-32-19)28-17-24(11-5-4-6-12-24)18-9-10-20(30-2)21(14-18)31-3;/h7-10,13-14H,4-6,11-12,15-17H2,1-3H3,(H,26,29)(H2,25,27,28);1H |
| InChIKey | SWHHUPZCUJNLPE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|