C22H35N3O4 — CID 111580877
methyl 3-[[N-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate (PubChem CID 111580877) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is methyl 3-[[N-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate.
| Compound Name | methyl 3-[[N-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 111580877 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | methyl 3-[[N-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate |
| SMILES | C/N=C(\NCC(C)C(=O)OC)NCC1(c2ccc(OC)c(OC)c2)CCCCC1 |
| InChI | InChI=1S/C22H35N3O4/c1-16(20(26)29-5)14-24-21(23-2)25-15-22(11-7-6-8-12-22)17-9-10-18(27-3)19(13-17)28-4/h9-10,13,16H,6-8,11-12,14-15H2,1-5H3,(H2,23,24,25) |
| InChIKey | YLLZPISALLSSJI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|