C24H41IN4O3 — CID 111580840
N-[2-[[N-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111580840) has the molecular formula C24H41IN4O3 and a molecular weight of 560.52 g/mol. Its IUPAC name is N-[2-[[N-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | N-[2-[[N-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111580840 |
| Molecular Formula | C24H41IN4O3 |
| Molecular Weight | 560.52 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | N-[2-[[N-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)C(C)(C)C)NCC1(c2ccc(OC)c(OC)c2)CCCCC1.I |
| InChI | InChI=1S/C24H40N4O3.HI/c1-23(2,3)21(29)26-14-15-27-22(25-4)28-17-24(12-8-7-9-13-24)18-10-11-19(30-5)20(16-18)31-6;/h10-11,16H,7-9,12-15,17H2,1-6H3,(H,26,29)(H2,25,27,28);1H |
| InChIKey | ALPPEUISZROEKT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|