C21H35N3O4S — CID 111580853
2-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-1-ethyl-3-(2-methylsulfonylethyl)guanidine (PubChem CID 111580853) has the molecular formula C21H35N3O4S and a molecular weight of 425.60 g/mol. Its IUPAC name is 2-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-1-ethyl-3-(2-methylsulfonylethyl)guanidine.
| Compound Name | 2-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-1-ethyl-3-(2-methylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111580853 |
| Molecular Formula | C21H35N3O4S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 2-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-1-ethyl-3-(2-methylsulfonylethyl)guanidine |
| SMILES | CCN/C(=N\CC1(c2ccc(OC)c(OC)c2)CCCCC1)NCCS(C)(=O)=O |
| InChI | InChI=1S/C21H35N3O4S/c1-5-22-20(23-13-14-29(4,25)26)24-16-21(11-7-6-8-12-21)17-9-10-18(27-2)19(15-17)28-3/h9-10,15H,5-8,11-14,16H2,1-4H3,(H2,22,23,24) |
| InChIKey | BUFMSCYMERBIBE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|