C25H21Cl2N3O2S — CID 1115810
2-(4-benzylpiperazin-1-yl)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 1115810) has the molecular formula C25H21Cl2N3O2S and a molecular weight of 498.44 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 1115810 |
| Molecular Formula | C25H21Cl2N3O2S |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCN(Cc3ccccc3)CC2)SC1=Cc1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C25H21Cl2N3O2S/c26-18-6-8-21(27)20(14-18)22-9-7-19(32-22)15-23-24(31)28-25(33-23)30-12-10-29(11-13-30)16-17-4-2-1-3-5-17/h1-9,14-15H,10-13,16H2 |
| InChIKey | XZHSEDBTXHCPFJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|