C24H28N4O2S — CID 19131402
(5Z)-2-(4-benzylpiperazin-1-yl)-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-1,3-thiazol-4-one (PubChem CID 19131402) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is (5Z)-2-(4-benzylpiperazin-1-yl)-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-(4-benzylpiperazin-1-yl)-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 19131402 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (5Z)-2-(4-benzylpiperazin-1-yl)-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCN(Cc3ccccc3)CC2)S/C1=C\c1ccc(N2CCCCC2)o1 |
| InChI | InChI=1S/C24H28N4O2S/c29-23-21(17-20-9-10-22(30-20)27-11-5-2-6-12-27)31-24(25-23)28-15-13-26(14-16-28)18-19-7-3-1-4-8-19/h1,3-4,7-10,17H,2,5-6,11-16,18H2/b21-17- |
| InChIKey | KZGIYFXQXAMQOZ-FXBPSFAMSA-N |
| XLogP | 4.06 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|