C22H36IN7S — CID 111581124
1-ethyl-2-(2-methyl-2-thiophen-2-ylpropyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111581124) has the molecular formula C22H36IN7S and a molecular weight of 557.55 g/mol. Its IUPAC name is 1-ethyl-2-(2-methyl-2-thiophen-2-ylpropyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-methyl-2-thiophen-2-ylpropyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111581124 |
| Molecular Formula | C22H36IN7S |
| Molecular Weight | 557.55 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | 1-ethyl-2-(2-methyl-2-thiophen-2-ylpropyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)c1cccs1)NCCCN1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C22H35N7S.HI/c1-4-23-20(27-18-22(2,3)19-8-5-17-30-19)24-11-7-12-28-13-15-29(16-14-28)21-25-9-6-10-26-21;/h5-6,8-10,17H,4,7,11-16,18H2,1-3H3,(H2,23,24,27);1H |
| InChIKey | GLKZYZONDPGXBP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|