C19H32N4OS — CID 111582214
2-[[(cyclohexylamino)-[(2-methyl-2-thiophen-2-ylpropyl)amino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111582214) has the molecular formula C19H32N4OS and a molecular weight of 364.56 g/mol. Its IUPAC name is 2-[[(cyclohexylamino)-[(2-methyl-2-thiophen-2-ylpropyl)amino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(cyclohexylamino)-[(2-methyl-2-thiophen-2-ylpropyl)amino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111582214 |
| Molecular Formula | C19H32N4OS |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 2-[[(cyclohexylamino)-[(2-methyl-2-thiophen-2-ylpropyl)amino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCC(C)(C)c1cccs1)NC1CCCCC1 |
| InChI | InChI=1S/C19H32N4OS/c1-19(2,16-11-8-12-25-16)14-21-18(20-13-17(24)23(3)4)22-15-9-6-5-7-10-15/h8,11-12,15H,5-7,9-10,13-14H2,1-4H3,(H2,20,21,22) |
| InChIKey | NUGGSRKESGMUJR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|