C15H21IN6OS — CID 111584151
1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111584151) has the molecular formula C15H21IN6OS and a molecular weight of 460.35 g/mol. Its IUPAC name is 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111584151 |
| Molecular Formula | C15H21IN6OS |
| Molecular Weight | 460.35 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cn2ccsc2n1)NCc1cc(C(C)C)no1.I |
| InChI | InChI=1S/C15H20N6OS.HI/c1-10(2)13-6-12(22-20-13)8-18-14(16-3)17-7-11-9-21-4-5-23-15(21)19-11;/h4-6,9-10H,7-8H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | LIIMVTJRMRGVGO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 79.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|