C18H25IN6O — CID 111585144
1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111585144) has the molecular formula C18H25IN6O and a molecular weight of 468.34 g/mol. Its IUPAC name is 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111585144 |
| Molecular Formula | C18H25IN6O |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cn2ccccc2n1)NCc1cc(C(C)C)no1.I |
| InChI | InChI=1S/C18H24N6O.HI/c1-13(2)16-10-15(25-23-16)11-21-18(19-3)20-8-7-14-12-24-9-5-4-6-17(24)22-14;/h4-6,9-10,12-13H,7-8,11H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | DPGGNESADXTBIL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|