C52H50I2N2O2 — CID 11158975
5-[3-(hexoxymethyl)-5-[2-(3-iodophenyl)ethynyl]phenyl]-2-[5-[3-(hexoxymethyl)-5-[2-(3-iodophenyl)ethynyl]phenyl]-2-pyridinyl]pyridine (PubChem CID 11158975) has the molecular formula C52H50I2N2O2 and a molecular weight of 988.79 g/mol. Its IUPAC name is 5-[3-(hexoxymethyl)-5-[2-(3-iodophenyl)ethynyl]phenyl]-2-[5-[3-(hexoxymethyl)-5-[2-(3-iodophenyl)ethynyl]phenyl]-2-pyridinyl]pyridine.
| Compound Name | 5-[3-(hexoxymethyl)-5-[2-(3-iodophenyl)ethynyl]phenyl]-2-[5-[3-(hexoxymethyl)-5-[2-(3-iodophenyl)ethynyl]phenyl]-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 11158975 |
| Molecular Formula | C52H50I2N2O2 |
| Molecular Weight | 988.79 g/mol |
| Exact Mass | 988.20 |
| IUPAC Name | 5-[3-(hexoxymethyl)-5-[2-(3-iodophenyl)ethynyl]phenyl]-2-[5-[3-(hexoxymethyl)-5-[2-(3-iodophenyl)ethynyl]phenyl]-2-pyridinyl]pyridine |
| SMILES | CCCCCCOCc1cc(C#Cc2cccc(I)c2)cc(-c2ccc(-c3ccc(-c4cc(C#Cc5cccc(I)c5)cc(COCCCCCC)c4)cn3)nc2)c1 |
| InChI | InChI=1S/C52H50I2N2O2/c1-3-5-7-9-25-57-37-43-27-41(19-17-39-13-11-15-49(53)33-39)29-47(31-43)45-21-23-51(55-35-45)52-24-22-46(36-56-52)48-30-42(20-18-40-14-12-16-50(54)34-40)28-44(32-48)38-58-26-10-8-6-4-2/h11-16,21-24,27-36H,3-10,25-26,37-38H2,1-2H3 |
| InChIKey | RXLZHIQBABYDRE-UHFFFAOYSA-N |
| XLogP | 13.68 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 988.79 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|