C45H42N4O5 — CID 121494222
4-[6-[5-[2-(3,11,18,21,24-pentaoxa-33-azatetracyclo[24.2.2.213,16.15,9]tritriaconta-1(29),5,7,9(33),13,15,26(30),27,31-nonaen-7-yl)ethynyl]-2-pyridinyl]-3-pyridinyl]aniline (PubChem CID 121494222) has the molecular formula C45H42N4O5 and a molecular weight of 718.85 g/mol. Its IUPAC name is 4-[6-[5-[2-(3,11,18,21,24-pentaoxa-33-azatetracyclo[24.2.2.213,16.15,9]tritriaconta-1(29),5,7,9(33),13,15,26(30),27,31-nonaen-7-yl)ethynyl]-2-pyridinyl]-3-pyridinyl]aniline.
| Compound Name | 4-[6-[5-[2-(3,11,18,21,24-pentaoxa-33-azatetracyclo[24.2.2.213,16.15,9]tritriaconta-1(29),5,7,9(33),13,15,26(30),27,31-nonaen-7-yl)ethynyl]-2-pyridinyl]-3-pyridinyl]aniline |
|---|---|
| PubChem CID | 121494222 |
| Molecular Formula | C45H42N4O5 |
| Molecular Weight | 718.85 g/mol |
| Exact Mass | 718.32 |
| IUPAC Name | 4-[6-[5-[2-(3,11,18,21,24-pentaoxa-33-azatetracyclo[24.2.2.213,16.15,9]tritriaconta-1(29),5,7,9(33),13,15,26(30),27,31-nonaen-7-yl)ethynyl]-2-pyridinyl]-3-pyridinyl]aniline |
| SMILES | Nc1ccc(-c2ccc(-c3ccc(C#Cc4cc5nc(c4)COCc4ccc(cc4)COCCOCCOCc4ccc(cc4)COC5)cn3)nc2)cc1 |
| InChI | InChI=1S/C45H42N4O5/c46-41-15-12-39(13-16-41)40-14-18-45(48-26-40)44-17-11-33(25-47-44)1-10-38-23-42-31-53-29-36-6-2-34(3-7-36)27-51-21-19-50-20-22-52-28-35-4-8-37(9-5-35)30-54-32-43(24-38)49-42/h2-9,11-18,23-26H,19-22,27-32,46H2 |
| InChIKey | KCSCRZTVYFVYMZ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.85 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|