C51H46N4O5 — CID 121494223
4-[6-[5-[2-[4-(3,11,18,21,24-pentaoxa-33-azatetracyclo[24.2.2.213,16.15,9]tritriaconta-1(29),5,7,9(33),13,15,26(30),27,31-nonaen-7-yl)phenyl]ethynyl]-2-pyridinyl]-3-pyridinyl]aniline (PubChem CID 121494223) has the molecular formula C51H46N4O5 and a molecular weight of 794.95 g/mol. Its IUPAC name is 4-[6-[5-[2-[4-(3,11,18,21,24-pentaoxa-33-azatetracyclo[24.2.2.213,16.15,9]tritriaconta-1(29),5,7,9(33),13,15,26(30),27,31-nonaen-7-yl)phenyl]ethynyl]-2-pyridinyl]-3-pyridinyl]aniline.
| Compound Name | 4-[6-[5-[2-[4-(3,11,18,21,24-pentaoxa-33-azatetracyclo[24.2.2.213,16.15,9]tritriaconta-1(29),5,7,9(33),13,15,26(30),27,31-nonaen-7-yl)phenyl]ethynyl]-2-pyridinyl]-3-pyridinyl]aniline |
|---|---|
| PubChem CID | 121494223 |
| Molecular Formula | C51H46N4O5 |
| Molecular Weight | 794.95 g/mol |
| Exact Mass | 794.35 |
| IUPAC Name | 4-[6-[5-[2-[4-(3,11,18,21,24-pentaoxa-33-azatetracyclo[24.2.2.213,16.15,9]tritriaconta-1(29),5,7,9(33),13,15,26(30),27,31-nonaen-7-yl)phenyl]ethynyl]-2-pyridinyl]-3-pyridinyl]aniline |
| SMILES | Nc1ccc(-c2ccc(-c3ccc(C#Cc4ccc(-c5cc6nc(c5)COCc5ccc(cc5)COCCOCCOCc5ccc(cc5)COC6)cc4)cn3)nc2)cc1 |
| InChI | InChI=1S/C51H46N4O5/c52-47-19-16-43(17-20-47)45-18-22-51(54-30-45)50-21-13-38(29-53-50)2-1-37-11-14-44(15-12-37)46-27-48-35-59-33-41-7-3-39(4-8-41)31-57-25-23-56-24-26-58-32-40-5-9-42(10-6-40)34-60-36-49(28-46)55-48/h3-22,27-30H,23-26,31-36,52H2 |
| InChIKey | AYQLMCLDOXQWCD-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.95 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|