C49H46N4O5 — CID 121494220
4-[6-[5-[4-(3,11,18,21,24-pentaoxa-33-azatetracyclo[24.2.2.213,16.15,9]tritriaconta-1(29),5,7,9(33),13,15,26(30),27,31-nonaen-7-yl)phenyl]-2-pyridinyl]-3-pyridinyl]aniline (PubChem CID 121494220) has the molecular formula C49H46N4O5 and a molecular weight of 770.93 g/mol. Its IUPAC name is 4-[6-[5-[4-(3,11,18,21,24-pentaoxa-33-azatetracyclo[24.2.2.213,16.15,9]tritriaconta-1(29),5,7,9(33),13,15,26(30),27,31-nonaen-7-yl)phenyl]-2-pyridinyl]-3-pyridinyl]aniline.
| Compound Name | 4-[6-[5-[4-(3,11,18,21,24-pentaoxa-33-azatetracyclo[24.2.2.213,16.15,9]tritriaconta-1(29),5,7,9(33),13,15,26(30),27,31-nonaen-7-yl)phenyl]-2-pyridinyl]-3-pyridinyl]aniline |
|---|---|
| PubChem CID | 121494220 |
| Molecular Formula | C49H46N4O5 |
| Molecular Weight | 770.93 g/mol |
| Exact Mass | 770.35 |
| IUPAC Name | 4-[6-[5-[4-(3,11,18,21,24-pentaoxa-33-azatetracyclo[24.2.2.213,16.15,9]tritriaconta-1(29),5,7,9(33),13,15,26(30),27,31-nonaen-7-yl)phenyl]-2-pyridinyl]-3-pyridinyl]aniline |
| SMILES | Nc1ccc(-c2ccc(-c3ccc(-c4ccc(-c5cc6nc(c5)COCc5ccc(cc5)COCCOCCOCc5ccc(cc5)COC6)cc4)cn3)nc2)cc1 |
| InChI | InChI=1S/C49H46N4O5/c50-45-17-13-40(14-18-45)43-16-20-49(52-28-43)48-19-15-42(27-51-48)39-9-11-41(12-10-39)44-25-46-33-57-31-37-5-1-35(2-6-37)29-55-23-21-54-22-24-56-30-36-3-7-38(8-4-36)32-58-34-47(26-44)53-46/h1-20,25-28H,21-24,29-34,50H2 |
| InChIKey | SHPNVWFQMSSKCY-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.93 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|