C43H42N4O5 — CID 121494224
4-[6-[5-(3,11,18,21,24-pentaoxa-33-azatetracyclo[24.2.2.213,16.15,9]tritriaconta-1(29),5,7,9(33),13,15,26(30),27,31-nonaen-7-yl)-2-pyridinyl]-3-pyridinyl]aniline (PubChem CID 121494224) has the molecular formula C43H42N4O5 and a molecular weight of 694.83 g/mol. Its IUPAC name is 4-[6-[5-(3,11,18,21,24-pentaoxa-33-azatetracyclo[24.2.2.213,16.15,9]tritriaconta-1(29),5,7,9(33),13,15,26(30),27,31-nonaen-7-yl)-2-pyridinyl]-3-pyridinyl]aniline.
| Compound Name | 4-[6-[5-(3,11,18,21,24-pentaoxa-33-azatetracyclo[24.2.2.213,16.15,9]tritriaconta-1(29),5,7,9(33),13,15,26(30),27,31-nonaen-7-yl)-2-pyridinyl]-3-pyridinyl]aniline |
|---|---|
| PubChem CID | 121494224 |
| Molecular Formula | C43H42N4O5 |
| Molecular Weight | 694.83 g/mol |
| Exact Mass | 694.32 |
| IUPAC Name | 4-[6-[5-(3,11,18,21,24-pentaoxa-33-azatetracyclo[24.2.2.213,16.15,9]tritriaconta-1(29),5,7,9(33),13,15,26(30),27,31-nonaen-7-yl)-2-pyridinyl]-3-pyridinyl]aniline |
| SMILES | Nc1ccc(-c2ccc(-c3ccc(-c4cc5nc(c4)COCc4ccc(cc4)COCCOCCOCc4ccc(cc4)COC5)cn3)nc2)cc1 |
| InChI | InChI=1S/C43H42N4O5/c44-39-13-9-35(10-14-39)36-11-15-42(45-23-36)43-16-12-37(24-46-43)38-21-40-29-51-27-33-5-1-31(2-6-33)25-49-19-17-48-18-20-50-26-32-3-7-34(8-4-32)28-52-30-41(22-38)47-40/h1-16,21-24H,17-20,25-30,44H2 |
| InChIKey | XDWXMBXZISJOSG-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.83 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|