C16H18N2O2 — CID 135029829
2-[(2R)-1,4-dioxan-2-yl]-4-methyl-6-(4-methyl-2-pyridinyl)pyridine (PubChem CID 135029829) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-[(2R)-1,4-dioxan-2-yl]-4-methyl-6-(4-methyl-2-pyridinyl)pyridine.
| Compound Name | 2-[(2R)-1,4-dioxan-2-yl]-4-methyl-6-(4-methyl-2-pyridinyl)pyridine |
|---|---|
| PubChem CID | 135029829 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-[(2R)-1,4-dioxan-2-yl]-4-methyl-6-(4-methyl-2-pyridinyl)pyridine |
| SMILES | Cc1ccnc(-c2cc(C)cc([C@@H]3COCCO3)n2)c1 |
| InChI | InChI=1S/C16H18N2O2/c1-11-3-4-17-13(7-11)14-8-12(2)9-15(18-14)16-10-19-5-6-20-16/h3-4,7-9,16H,5-6,10H2,1-2H3/t16-/m0/s1 |
| InChIKey | BRINZSNQCAPDCW-INIZCTEOSA-N |
| XLogP | 2.85 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |