C24H32N8O — CID 111592089
2-methyl-1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111592089) has the molecular formula C24H32N8O and a molecular weight of 448.58 g/mol. Its IUPAC name is 2-methyl-1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 2-methyl-1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111592089 |
| Molecular Formula | C24H32N8O |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 2-methyl-1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCN1CCN(c2ncccn2)CC1)NCc1coc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C24H32N8O/c1-19-5-7-20(8-6-19)22-30-21(18-33-22)17-29-23(25-2)26-11-4-12-31-13-15-32(16-14-31)24-27-9-3-10-28-24/h3,5-10,18H,4,11-17H2,1-2H3,(H2,25,26,29) |
| InChIKey | LGTWLUDYLOKFRF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|