C21H40IN5O — CID 111593076
2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-[2-cyclohexyl-2-(dimethylamino)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111593076) has the molecular formula C21H40IN5O and a molecular weight of 505.49 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-[2-cyclohexyl-2-(dimethylamino)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-[2-cyclohexyl-2-(dimethylamino)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111593076 |
| Molecular Formula | C21H40IN5O |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-[2-cyclohexyl-2-(dimethylamino)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C(C)(C)C)o1)NCC(C1CCCCC1)N(C)C.I |
| InChI | InChI=1S/C21H39N5O.HI/c1-7-22-20(25-15-19-23-14-18(27-19)21(2,3)4)24-13-17(26(5)6)16-11-9-8-10-12-16;/h14,16-17H,7-13,15H2,1-6H3,(H2,22,24,25);1H |
| InChIKey | PAJYDPSHEXHMBI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|