C20H38N6O — CID 111593128
2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine (PubChem CID 111593128) has the molecular formula C20H38N6O and a molecular weight of 378.57 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111593128 |
| Molecular Formula | C20H38N6O |
| Molecular Weight | 378.57 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(C(C)(C)C)o1)NCC(C)CN1CCN(C)CC1 |
| InChI | InChI=1S/C20H38N6O/c1-7-21-19(24-14-18-22-13-17(27-18)20(3,4)5)23-12-16(2)15-26-10-8-25(6)9-11-26/h13,16H,7-12,14-15H2,1-6H3,(H2,21,23,24) |
| InChIKey | YZYQBQWLQVMJQV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.57 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|