C19H36N6O — CID 111595320
2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine (PubChem CID 111595320) has the molecular formula C19H36N6O and a molecular weight of 364.54 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine.
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111595320 |
| Molecular Formula | C19H36N6O |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(C(C)(C)C)o1)NCCN1CCCN(C)CC1 |
| InChI | InChI=1S/C19H36N6O/c1-6-20-18(21-8-11-25-10-7-9-24(5)12-13-25)23-15-17-22-14-16(26-17)19(2,3)4/h14H,6-13,15H2,1-5H3,(H2,20,21,23) |
| InChIKey | FSABUWNMVTUPLP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|