C21H40N6O — CID 111594030
2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]guanidine (PubChem CID 111594030) has the molecular formula C21H40N6O and a molecular weight of 392.59 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]guanidine.
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]guanidine |
|---|---|
| PubChem CID | 111594030 |
| Molecular Formula | C21H40N6O |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(C(C)(C)C)o1)NCC(C)CN1CCN(CC)CC1 |
| InChI | InChI=1S/C21H40N6O/c1-7-22-20(25-15-19-23-14-18(28-19)21(4,5)6)24-13-17(3)16-27-11-9-26(8-2)10-12-27/h14,17H,7-13,15-16H2,1-6H3,(H2,22,24,25) |
| InChIKey | CBMGWDZNJTXKPK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|