C24H37N5O — CID 111593097
2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]-3-ethylguanidine (PubChem CID 111593097) has the molecular formula C24H37N5O and a molecular weight of 411.59 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]-3-ethylguanidine.
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111593097 |
| Molecular Formula | C24H37N5O |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.30 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ncc(C(C)(C)C)o1)NCC(C)(C)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C24H37N5O/c1-7-25-22(27-15-21-26-14-20(30-21)23(2,3)4)28-17-24(5,6)29-13-12-18-10-8-9-11-19(18)16-29/h8-11,14H,7,12-13,15-17H2,1-6H3,(H2,25,27,28) |
| InChIKey | ZGSLPUXQOZHQIG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|