C12H18O2 — CID 11159867
1-[(4aS,8aR)-8a-hydroxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-yl]ethanone (PubChem CID 11159867) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 1-[(4aS,8aR)-8a-hydroxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-yl]ethanone.
| Compound Name | 1-[(4aS,8aR)-8a-hydroxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-yl]ethanone |
|---|---|
| PubChem CID | 11159867 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 1-[(4aS,8aR)-8a-hydroxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-yl]ethanone |
| SMILES | CC(=O)C1=CCC[C@@H]2CCCC[C@]12O |
| InChI | InChI=1S/C12H18O2/c1-9(13)11-7-4-6-10-5-2-3-8-12(10,11)14/h7,10,14H,2-6,8H2,1H3/t10-,12+/m0/s1 |
| InChIKey | GTUMAHHCRZZNLK-CMPLNLGQSA-N |
| XLogP | 2.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |