C17H25F3N4O2 — CID 111600174
1-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111600174) has the molecular formula C17H25F3N4O2 and a molecular weight of 374.41 g/mol. Its IUPAC name is 1-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111600174 |
| Molecular Formula | C17H25F3N4O2 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 1-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | COCCN1CCCC1CN/C(N)=N/Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H25F3N4O2/c1-25-10-9-24-8-2-3-14(24)12-23-16(21)22-11-13-4-6-15(7-5-13)26-17(18,19)20/h4-7,14H,2-3,8-12H2,1H3,(H3,21,22,23) |
| InChIKey | IPTHVAWGAQPQMZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|