C18H22F2IN3 — CID 111600874
2-benzyl-3-[2-(2,5-difluorophenyl)ethyl]-1,1-dimethylguanidine;hydroiodide (PubChem CID 111600874) has the molecular formula C18H22F2IN3 and a molecular weight of 445.30 g/mol. Its IUPAC name is 2-benzyl-3-[2-(2,5-difluorophenyl)ethyl]-1,1-dimethylguanidine;hydroiodide.
| Compound Name | 2-benzyl-3-[2-(2,5-difluorophenyl)ethyl]-1,1-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111600874 |
| Molecular Formula | C18H22F2IN3 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 2-benzyl-3-[2-(2,5-difluorophenyl)ethyl]-1,1-dimethylguanidine;hydroiodide |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NCCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C18H21F2N3.HI/c1-23(2)18(22-13-14-6-4-3-5-7-14)21-11-10-15-12-16(19)8-9-17(15)20;/h3-9,12H,10-11,13H2,1-2H3,(H,21,22);1H |
| InChIKey | BKBOSBQWSIVUPQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|