C12H18IN5OS — CID 111602244
1-ethyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-2-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111602244) has the molecular formula C12H18IN5OS and a molecular weight of 407.28 g/mol. Its IUPAC name is 1-ethyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-2-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-2-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111602244 |
| Molecular Formula | C12H18IN5OS |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 1-ethyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-2-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccsc1)NCc1noc(C)n1.I |
| InChI | InChI=1S/C12H17N5OS.HI/c1-3-13-12(14-6-10-4-5-19-8-10)15-7-11-16-9(2)18-17-11;/h4-5,8H,3,6-7H2,1-2H3,(H2,13,14,15);1H |
| InChIKey | YWSYOMPHNAXQDA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|