C14H19FIN5O — CID 111601854
1-ethyl-2-[(2-fluorophenyl)methyl]-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111601854) has the molecular formula C14H19FIN5O and a molecular weight of 419.24 g/mol. Its IUPAC name is 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111601854 |
| Molecular Formula | C14H19FIN5O |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1F)NCc1noc(C)n1.I |
| InChI | InChI=1S/C14H18FN5O.HI/c1-3-16-14(18-9-13-19-10(2)21-20-13)17-8-11-6-4-5-7-12(11)15;/h4-7H,3,8-9H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | ZYSPWOARTDTKGX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|