C8H15NO4S — CID 11160359
tert-butyl (3R)-1,1-dioxo-1,2-thiazolidine-3-carboxylate (PubChem CID 11160359) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is tert-butyl (3R)-1,1-dioxo-1,2-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl (3R)-1,1-dioxo-1,2-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11160359 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | tert-butyl (3R)-1,1-dioxo-1,2-thiazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1CCS(=O)(=O)N1 |
| InChI | InChI=1S/C8H15NO4S/c1-8(2,3)13-7(10)6-4-5-14(11,12)9-6/h6,9H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | JFUBUVMYQZXKSS-ZCFIWIBFSA-N |
| XLogP | 0.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |