C13H23N3O — CID 11160742
2-ethoxy-N,N-di(propan-2-yl)-5H-1,3-diazepin-4-amine (PubChem CID 11160742) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-ethoxy-N,N-di(propan-2-yl)-5H-1,3-diazepin-4-amine.
| Compound Name | 2-ethoxy-N,N-di(propan-2-yl)-5H-1,3-diazepin-4-amine |
|---|---|
| PubChem CID | 11160742 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 2-ethoxy-N,N-di(propan-2-yl)-5H-1,3-diazepin-4-amine |
| SMILES | CCOC1=NC=CCC(N(C(C)C)C(C)C)=N1 |
| InChI | InChI=1S/C13H23N3O/c1-6-17-13-14-9-7-8-12(15-13)16(10(2)3)11(4)5/h7,9-11H,6,8H2,1-5H3 |
| InChIKey | MLIRVUBRMHYSLY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |