C11H19LiN2O2 — CID 10998477
lithium (2S)-3,6-diethoxy-2-propan-2-yl-2H-pyrazin-1-ide (PubChem CID 10998477) has the molecular formula C11H19LiN2O2 and a molecular weight of 218.23 g/mol. Its IUPAC name is lithium (2S)-3,6-diethoxy-2-propan-2-yl-2H-pyrazin-1-ide.
| Compound Name | lithium (2S)-3,6-diethoxy-2-propan-2-yl-2H-pyrazin-1-ide |
|---|---|
| PubChem CID | 10998477 |
| Molecular Formula | C11H19LiN2O2 |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | lithium (2S)-3,6-diethoxy-2-propan-2-yl-2H-pyrazin-1-ide |
| SMILES | CCOC1=CN=C(OCC)[C@H](C(C)C)[N-]1.[Li+] |
| InChI | InChI=1S/C11H19N2O2.Li/c1-5-14-9-7-12-11(15-6-2)10(13-9)8(3)4;/h7-8,10H,5-6H2,1-4H3;/q-1;+1/t10-;/m0./s1 |
| InChIKey | FYONGHKDIDRFJX-PPHPATTJSA-N |
| XLogP | -0.33 |
| TPSA | 44.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |