About ethene;2-propan-2-yl-3H-pyrrole
ethene;2-propan-2-yl-3H-pyrrole (PubChem CID 142624380) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is ethene;2-propan-2-yl-3H-pyrrole.
Molecular Properties
| Compound Name | ethene;2-propan-2-yl-3H-pyrrole |
| PubChem CID | 142624380 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | ethene;2-propan-2-yl-3H-pyrrole |
| SMILES | C=C.CC(C)C1=NC=CC1 |
| InChI | InChI=1S/C7H11N.C2H4/c1-6(2)7-4-3-5-8-7;1-2/h3,5-6H,4H2,1-2H3;1-2H2 |
| InChIKey | PUHMSUXESFVQCG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;2-propan-2-yl-3H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;2-propan-2-yl-3H-pyrrole?
The IUPAC name of ethene;2-propan-2-yl-3H-pyrrole (CID 142624380) is ethene;2-propan-2-yl-3H-pyrrole.
What is the SMILES notation for ethene;2-propan-2-yl-3H-pyrrole?
The canonical SMILES for ethene;2-propan-2-yl-3H-pyrrole is C=C.CC(C)C1=NC=CC1.
What is the InChIKey of ethene;2-propan-2-yl-3H-pyrrole?
The InChIKey is PUHMSUXESFVQCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N.C2H4/c1-6(2)7-4-3-5-8-7;1-2/h3,5-6H,4H2,1-2H3;1-2H2.
What are the key properties of ethene;2-propan-2-yl-3H-pyrrole?
ethene;2-propan-2-yl-3H-pyrrole has a molecular weight of 137.23 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;2-propan-2-yl-3H-pyrrole is sourced from PubChem (CID 142624380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).