C12H25N3O2S — CID 111610006
methyl 2-methyl-3-[[N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]propanoate (PubChem CID 111610006) has the molecular formula C12H25N3O2S and a molecular weight of 275.42 g/mol. Its IUPAC name is methyl 2-methyl-3-[[N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]propanoate.
| Compound Name | methyl 2-methyl-3-[[N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]propanoate |
|---|---|
| PubChem CID | 111610006 |
| Molecular Formula | C12H25N3O2S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | methyl 2-methyl-3-[[N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]propanoate |
| SMILES | C/N=C(\NCC(C)C(=O)OC)NCC(C)(C)SC |
| InChI | InChI=1S/C12H25N3O2S/c1-9(10(16)17-5)7-14-11(13-4)15-8-12(2,3)18-6/h9H,7-8H2,1-6H3,(H2,13,14,15) |
| InChIKey | RKAZTLSSPBCBCM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|