C20H35IN4OS — CID 111611001
N-butan-2-yl-4-[[[ethylamino-[(2-methyl-2-methylsulfanylpropyl)amino]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111611001) has the molecular formula C20H35IN4OS and a molecular weight of 506.50 g/mol. Its IUPAC name is N-butan-2-yl-4-[[[ethylamino-[(2-methyl-2-methylsulfanylpropyl)amino]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-butan-2-yl-4-[[[ethylamino-[(2-methyl-2-methylsulfanylpropyl)amino]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111611001 |
| Molecular Formula | C20H35IN4OS |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | N-butan-2-yl-4-[[[ethylamino-[(2-methyl-2-methylsulfanylpropyl)amino]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NC(C)CC)cc1)NCC(C)(C)SC.I |
| InChI | InChI=1S/C20H34N4OS.HI/c1-7-15(3)24-18(25)17-11-9-16(10-12-17)13-22-19(21-8-2)23-14-20(4,5)26-6;/h9-12,15H,7-8,13-14H2,1-6H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | CICXFYWTMHHDSV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|