C15H23ClO — CID 11161142
(3R,3aR,4R,7aR)-4-(2-chloroethyl)-7a-methyl-3-prop-1-en-2-yl-2,3,3a,4,6,7-hexahydro-1H-inden-5-one (PubChem CID 11161142) has the molecular formula C15H23ClO and a molecular weight of 254.80 g/mol. Its IUPAC name is (3R,3aR,4R,7aR)-4-(2-chloroethyl)-7a-methyl-3-prop-1-en-2-yl-2,3,3a,4,6,7-hexahydro-1H-inden-5-one.
| Compound Name | (3R,3aR,4R,7aR)-4-(2-chloroethyl)-7a-methyl-3-prop-1-en-2-yl-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 11161142 |
| Molecular Formula | C15H23ClO |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | (3R,3aR,4R,7aR)-4-(2-chloroethyl)-7a-methyl-3-prop-1-en-2-yl-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C)CCC(=O)[C@H](CCCl)[C@@H]12 |
| InChI | InChI=1S/C15H23ClO/c1-10(2)11-4-7-15(3)8-5-13(17)12(6-9-16)14(11)15/h11-12,14H,1,4-9H2,2-3H3/t11-,12-,14+,15+/m0/s1 |
| InChIKey | OQSKAWLEYQEEBA-DDHJSBNISA-N |
| XLogP | 4.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|