C14H12O3S — CID 11161281
2-(4-hydroxyphenyl)-2,3-dihydro-1,4-benzoxathiin-6-ol (PubChem CID 11161281) has the molecular formula C14H12O3S and a molecular weight of 260.31 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-2,3-dihydro-1,4-benzoxathiin-6-ol.
| Compound Name | 2-(4-hydroxyphenyl)-2,3-dihydro-1,4-benzoxathiin-6-ol |
|---|---|
| PubChem CID | 11161281 |
| Molecular Formula | C14H12O3S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 2-(4-hydroxyphenyl)-2,3-dihydro-1,4-benzoxathiin-6-ol |
| SMILES | Oc1ccc(C2CSc3cc(O)ccc3O2)cc1 |
| InChI | InChI=1S/C14H12O3S/c15-10-3-1-9(2-4-10)13-8-18-14-7-11(16)5-6-12(14)17-13/h1-7,13,15-16H,8H2 |
| InChIKey | MDHLORYEYMIOHG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |