C20H37IN4O2S — CID 111614275
1-[7-(dimethylamino)heptyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111614275) has the molecular formula C20H37IN4O2S and a molecular weight of 524.51 g/mol. Its IUPAC name is 1-[7-(dimethylamino)heptyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[7-(dimethylamino)heptyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111614275 |
| Molecular Formula | C20H37IN4O2S |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 1-[7-(dimethylamino)heptyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCCCCN(C)C)NCCc1ccc(S(C)(=O)=O)cc1.I |
| InChI | InChI=1S/C20H36N4O2S.HI/c1-21-20(22-15-8-6-5-7-9-17-24(2)3)23-16-14-18-10-12-19(13-11-18)27(4,25)26;/h10-13H,5-9,14-17H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | AOIZVGRQIVIGJO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|