C21H29FIN3O3S — CID 111613909
1-[4-(4-fluorophenoxy)butyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111613909) has the molecular formula C21H29FIN3O3S and a molecular weight of 549.45 g/mol. Its IUPAC name is 1-[4-(4-fluorophenoxy)butyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[4-(4-fluorophenoxy)butyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111613909 |
| Molecular Formula | C21H29FIN3O3S |
| Molecular Weight | 549.45 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | 1-[4-(4-fluorophenoxy)butyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCOc1ccc(F)cc1)NCCc1ccc(S(C)(=O)=O)cc1.I |
| InChI | InChI=1S/C21H28FN3O3S.HI/c1-23-21(24-14-3-4-16-28-19-9-7-18(22)8-10-19)25-15-13-17-5-11-20(12-6-17)29(2,26)27;/h5-12H,3-4,13-16H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | SPPREAKLKBIYIV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|