C17H30F3N5S — CID 111616208
1-[2-(diethylamino)-4-methylpentyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111616208) has the molecular formula C17H30F3N5S and a molecular weight of 393.52 g/mol. Its IUPAC name is 1-[2-(diethylamino)-4-methylpentyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-[2-(diethylamino)-4-methylpentyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111616208 |
| Molecular Formula | C17H30F3N5S |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 1-[2-(diethylamino)-4-methylpentyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | CCN(CC)C(CN/C(=N\C)NCc1nc(C(F)(F)F)cs1)CC(C)C |
| InChI | InChI=1S/C17H30F3N5S/c1-6-25(7-2)13(8-12(3)4)9-22-16(21-5)23-10-15-24-14(11-26-15)17(18,19)20/h11-13H,6-10H2,1-5H3,(H2,21,22,23) |
| InChIKey | DXEOSGSFZSASTH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|