C16H24F3IN6S — CID 111617258
1-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111617258) has the molecular formula C16H24F3IN6S and a molecular weight of 516.38 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111617258 |
| Molecular Formula | C16H24F3IN6S |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nc(C(F)(F)F)cs1)NCC(C)Cn1nc(C)cc1C.I |
| InChI | InChI=1S/C16H23F3N6S.HI/c1-10(8-25-12(3)5-11(2)24-25)6-21-15(20-4)22-7-14-23-13(9-26-14)16(17,18)19;/h5,9-10H,6-8H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | BZEMKKVPDHNQPE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|