C20H28F3N5O — CID 111870823
1-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine (PubChem CID 111870823) has the molecular formula C20H28F3N5O and a molecular weight of 411.47 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111870823 |
| Molecular Formula | C20H28F3N5O |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(OCC(F)(F)F)cc1)NCC(C)Cn1nc(C)cc1C |
| InChI | InChI=1S/C20H28F3N5O/c1-14(12-28-16(3)9-15(2)27-28)10-25-19(24-4)26-11-17-5-7-18(8-6-17)29-13-20(21,22)23/h5-9,14H,10-13H2,1-4H3,(H2,24,25,26) |
| InChIKey | IDKBCFJFPQRRTP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|